About [1-Amino-2-[2-(3,4,5-trimethylpyrazol-1-yl)ethyl]cyclopentyl]methanol
[1-Amino-2-[2-(3,4,5-trimethylpyrazol-1-yl)ethyl]cyclopentyl]methanol (PubChem CID 79581209) has the molecular formula C14H25N3O
and a molecular weight of 251.37 g/mol. Its IUPAC name is [1-amino-2-[2-(3,4,5-trimethylpyrazol-1-yl)ethyl]cyclopentyl]methanol.
Molecular Properties
| Compound Name | [1-Amino-2-[2-(3,4,5-trimethylpyrazol-1-yl)ethyl]cyclopentyl]methanol |
| PubChem CID | 79581209 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | [1-amino-2-[2-(3,4,5-trimethylpyrazol-1-yl)ethyl]cyclopentyl]methanol |
| SMILES | CC1=C(N(N=C1C)CCC2CCCC2(CO)N)C |
| InChI | InChI=1S/C14H25N3O/c1-10-11(2)16-17(12(10)3)8-6-13-5-4-7-14(13,15)9-18/h13,18H,4-9,15H2,1-3H3 |
| InChIKey | DYCJKNGYTYNNPW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 64.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | 286 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-Amino-2-[2-(3,4,5-trimethylpyrazol-1-yl)ethyl]cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-Amino-2-[2-(3,4,5-trimethylpyrazol-1-yl)ethyl]cyclopentyl]methanol?
The IUPAC name of [1-Amino-2-[2-(3,4,5-trimethylpyrazol-1-yl)ethyl]cyclopentyl]methanol (CID 79581209) is [1-amino-2-[2-(3,4,5-trimethylpyrazol-1-yl)ethyl]cyclopentyl]methanol.
What is the SMILES notation for [1-Amino-2-[2-(3,4,5-trimethylpyrazol-1-yl)ethyl]cyclopentyl]methanol?
The canonical SMILES for [1-Amino-2-[2-(3,4,5-trimethylpyrazol-1-yl)ethyl]cyclopentyl]methanol is CC1=C(N(N=C1C)CCC2CCCC2(CO)N)C.
What is the InChIKey of [1-Amino-2-[2-(3,4,5-trimethylpyrazol-1-yl)ethyl]cyclopentyl]methanol?
The InChIKey is DYCJKNGYTYNNPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3O/c1-10-11(2)16-17(12(10)3)8-6-13-5-4-7-14(13,15)9-18/h13,18H,4-9,15H2,1-3H3.
What are the key properties of [1-Amino-2-[2-(3,4,5-trimethylpyrazol-1-yl)ethyl]cyclopentyl]methanol?
[1-Amino-2-[2-(3,4,5-trimethylpyrazol-1-yl)ethyl]cyclopentyl]methanol has a molecular weight of 251.37 g/mol, XLogP of 1.10, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-Amino-2-[2-(3,4,5-trimethylpyrazol-1-yl)ethyl]cyclopentyl]methanol is sourced from PubChem (CID 79581209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).