About [2-[2-(2,3-difluorophenoxy)ethyl]-1-(methylamino)cyclopentyl]methanol
[2-[2-(2,3-difluorophenoxy)ethyl]-1-(methylamino)cyclopentyl]methanol (PubChem CID 79581372) has the molecular formula C15H21F2NO2
and a molecular weight of 285.33 g/mol. Its IUPAC name is [2-[2-(2,3-difluorophenoxy)ethyl]-1-(methylamino)cyclopentyl]methanol.
Molecular Properties
| Compound Name | [2-[2-(2,3-difluorophenoxy)ethyl]-1-(methylamino)cyclopentyl]methanol |
| PubChem CID | 79581372 |
| Molecular Formula | C15H21F2NO2 |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | [2-[2-(2,3-difluorophenoxy)ethyl]-1-(methylamino)cyclopentyl]methanol |
| SMILES | CNC1(CO)CCCC1CCOc1cccc(F)c1F |
| InChI | InChI=1S/C15H21F2NO2/c1-18-15(10-19)8-3-4-11(15)7-9-20-13-6-2-5-12(16)14(13)17/h2,5-6,11,18-19H,3-4,7-10H2,1H3 |
| InChIKey | YIMAALGCUOTNAR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-[2-(2,3-difluorophenoxy)ethyl]-1-(methylamino)cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(2,3-difluorophenoxy)ethyl]-1-(methylamino)cyclopentyl]methanol?
The IUPAC name of [2-[2-(2,3-difluorophenoxy)ethyl]-1-(methylamino)cyclopentyl]methanol (CID 79581372) is [2-[2-(2,3-difluorophenoxy)ethyl]-1-(methylamino)cyclopentyl]methanol.
What is the SMILES notation for [2-[2-(2,3-difluorophenoxy)ethyl]-1-(methylamino)cyclopentyl]methanol?
The canonical SMILES for [2-[2-(2,3-difluorophenoxy)ethyl]-1-(methylamino)cyclopentyl]methanol is CNC1(CO)CCCC1CCOc1cccc(F)c1F.
What is the InChIKey of [2-[2-(2,3-difluorophenoxy)ethyl]-1-(methylamino)cyclopentyl]methanol?
The InChIKey is YIMAALGCUOTNAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F2NO2/c1-18-15(10-19)8-3-4-11(15)7-9-20-13-6-2-5-12(16)14(13)17/h2,5-6,11,18-19H,3-4,7-10H2,1H3.
What are the key properties of [2-[2-(2,3-difluorophenoxy)ethyl]-1-(methylamino)cyclopentyl]methanol?
[2-[2-(2,3-difluorophenoxy)ethyl]-1-(methylamino)cyclopentyl]methanol has a molecular weight of 285.33 g/mol, XLogP of 2.48, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(2,3-difluorophenoxy)ethyl]-1-(methylamino)cyclopentyl]methanol is sourced from PubChem (CID 79581372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).