C13H20F3NO3 — CID 79581546
1-(cyclopropylamino)-2-[2-(2,2,2-trifluoroethoxy)ethyl]cyclopentane-1-carboxylic acid (PubChem CID 79581546) has the molecular formula C13H20F3NO3 and a molecular weight of 295.30 g/mol. Its IUPAC name is 1-(cyclopropylamino)-2-[2-(2,2,2-trifluoroethoxy)ethyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-(cyclopropylamino)-2-[2-(2,2,2-trifluoroethoxy)ethyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 79581546 |
| Molecular Formula | C13H20F3NO3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 1-(cyclopropylamino)-2-[2-(2,2,2-trifluoroethoxy)ethyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1(NC2CC2)CCCC1CCOCC(F)(F)F |
| InChI | InChI=1S/C13H20F3NO3/c14-13(15,16)8-20-7-5-9-2-1-6-12(9,11(18)19)17-10-3-4-10/h9-10,17H,1-8H2,(H,18,19) |
| InChIKey | AWSOMMILLGGAQO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|