C16H28N2OS — CID 79582214
2-(2-cyclopentylsulfanylethyl)-1-(cyclopropylamino)cyclopentane-1-carboxamide (PubChem CID 79582214) has the molecular formula C16H28N2OS and a molecular weight of 296.48 g/mol. Its IUPAC name is 2-(2-cyclopentylsulfanylethyl)-1-(cyclopropylamino)cyclopentane-1-carboxamide.
| Compound Name | 2-(2-cyclopentylsulfanylethyl)-1-(cyclopropylamino)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 79582214 |
| Molecular Formula | C16H28N2OS |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 2-(2-cyclopentylsulfanylethyl)-1-(cyclopropylamino)cyclopentane-1-carboxamide |
| SMILES | NC(=O)C1(NC2CC2)CCCC1CCSC1CCCC1 |
| InChI | InChI=1S/C16H28N2OS/c17-15(19)16(18-13-7-8-13)10-3-4-12(16)9-11-20-14-5-1-2-6-14/h12-14,18H,1-11H2,(H2,17,19) |
| InChIKey | IFMSJOFDTWDVBR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |