C14H20ClNO — CID 79582982
4-chloro-2-[(3-methylcyclohexyl)oxymethyl]aniline (PubChem CID 79582982) has the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. Its IUPAC name is 4-chloro-2-[(3-methylcyclohexyl)oxymethyl]aniline.
| Compound Name | 4-chloro-2-[(3-methylcyclohexyl)oxymethyl]aniline |
|---|---|
| PubChem CID | 79582982 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 4-chloro-2-[(3-methylcyclohexyl)oxymethyl]aniline |
| SMILES | CC1CCCC(OCc2cc(Cl)ccc2N)C1 |
| InChI | InChI=1S/C14H20ClNO/c1-10-3-2-4-13(7-10)17-9-11-8-12(15)5-6-14(11)16/h5-6,8,10,13H,2-4,7,9,16H2,1H3 |
| InChIKey | TXFVJUPEMQPUIE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|