About 2-(1,5-dimethylpyrazol-4-yl)-2,3-dihydropyran-4-one
2-(1,5-dimethylpyrazol-4-yl)-2,3-dihydropyran-4-one (PubChem CID 79583873) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-(1,5-dimethylpyrazol-4-yl)-2,3-dihydropyran-4-one.
Molecular Properties
| Compound Name | 2-(1,5-dimethylpyrazol-4-yl)-2,3-dihydropyran-4-one |
| PubChem CID | 79583873 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-(1,5-dimethylpyrazol-4-yl)-2,3-dihydropyran-4-one |
| SMILES | Cc1c(C2CC(=O)C=CO2)cnn1C |
| InChI | InChI=1S/C10H12N2O2/c1-7-9(6-11-12(7)2)10-5-8(13)3-4-14-10/h3-4,6,10H,5H2,1-2H3 |
| InChIKey | LCYNEOVRMYDUQL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,5-dimethylpyrazol-4-yl)-2,3-dihydropyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,5-dimethylpyrazol-4-yl)-2,3-dihydropyran-4-one?
The IUPAC name of 2-(1,5-dimethylpyrazol-4-yl)-2,3-dihydropyran-4-one (CID 79583873) is 2-(1,5-dimethylpyrazol-4-yl)-2,3-dihydropyran-4-one.
What is the SMILES notation for 2-(1,5-dimethylpyrazol-4-yl)-2,3-dihydropyran-4-one?
The canonical SMILES for 2-(1,5-dimethylpyrazol-4-yl)-2,3-dihydropyran-4-one is Cc1c(C2CC(=O)C=CO2)cnn1C.
What is the InChIKey of 2-(1,5-dimethylpyrazol-4-yl)-2,3-dihydropyran-4-one?
The InChIKey is LCYNEOVRMYDUQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2/c1-7-9(6-11-12(7)2)10-5-8(13)3-4-14-10/h3-4,6,10H,5H2,1-2H3.
What are the key properties of 2-(1,5-dimethylpyrazol-4-yl)-2,3-dihydropyran-4-one?
2-(1,5-dimethylpyrazol-4-yl)-2,3-dihydropyran-4-one has a molecular weight of 192.22 g/mol, XLogP of 1.27, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,5-dimethylpyrazol-4-yl)-2,3-dihydropyran-4-one is sourced from PubChem (CID 79583873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).