About 2-(azepan-1-yl)-2-(1,5-dimethylpyrazol-4-yl)acetonitrile
2-(azepan-1-yl)-2-(1,5-dimethylpyrazol-4-yl)acetonitrile (PubChem CID 79583925) has the molecular formula C13H20N4
and a molecular weight of 232.33 g/mol. Its IUPAC name is 2-(azepan-1-yl)-2-(1,5-dimethylpyrazol-4-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(azepan-1-yl)-2-(1,5-dimethylpyrazol-4-yl)acetonitrile |
| PubChem CID | 79583925 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 2-(azepan-1-yl)-2-(1,5-dimethylpyrazol-4-yl)acetonitrile |
| SMILES | Cc1c(C(C#N)N2CCCCCC2)cnn1C |
| InChI | InChI=1S/C13H20N4/c1-11-12(10-15-16(11)2)13(9-14)17-7-5-3-4-6-8-17/h10,13H,3-8H2,1-2H3 |
| InChIKey | YCIIDBHZLSNWFX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 44.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(azepan-1-yl)-2-(1,5-dimethylpyrazol-4-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azepan-1-yl)-2-(1,5-dimethylpyrazol-4-yl)acetonitrile?
The IUPAC name of 2-(azepan-1-yl)-2-(1,5-dimethylpyrazol-4-yl)acetonitrile (CID 79583925) is 2-(azepan-1-yl)-2-(1,5-dimethylpyrazol-4-yl)acetonitrile.
What is the SMILES notation for 2-(azepan-1-yl)-2-(1,5-dimethylpyrazol-4-yl)acetonitrile?
The canonical SMILES for 2-(azepan-1-yl)-2-(1,5-dimethylpyrazol-4-yl)acetonitrile is Cc1c(C(C#N)N2CCCCCC2)cnn1C.
What is the InChIKey of 2-(azepan-1-yl)-2-(1,5-dimethylpyrazol-4-yl)acetonitrile?
The InChIKey is YCIIDBHZLSNWFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4/c1-11-12(10-15-16(11)2)13(9-14)17-7-5-3-4-6-8-17/h10,13H,3-8H2,1-2H3.
What are the key properties of 2-(azepan-1-yl)-2-(1,5-dimethylpyrazol-4-yl)acetonitrile?
2-(azepan-1-yl)-2-(1,5-dimethylpyrazol-4-yl)acetonitrile has a molecular weight of 232.33 g/mol, XLogP of 2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azepan-1-yl)-2-(1,5-dimethylpyrazol-4-yl)acetonitrile is sourced from PubChem (CID 79583925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).