C14H19N3O2 — CID 79584117
2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyanilino)ethanol (PubChem CID 79584117) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyanilino)ethanol.
| Compound Name | 2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyanilino)ethanol |
|---|---|
| PubChem CID | 79584117 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-(1,5-dimethylpyrazol-4-yl)-2-(2-methoxyanilino)ethanol |
| SMILES | COc1ccccc1NC(CO)c1cnn(C)c1C |
| InChI | InChI=1S/C14H19N3O2/c1-10-11(8-15-17(10)2)13(9-18)16-12-6-4-5-7-14(12)19-3/h4-8,13,16,18H,9H2,1-3H3 |
| InChIKey | IZHFFFGYLHNVBB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |