About [2-(1,5-dimethylpyrazol-4-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine
[2-(1,5-dimethylpyrazol-4-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine (PubChem CID 79584800) has the molecular formula C10H13FN6
and a molecular weight of 236.25 g/mol. Its IUPAC name is [2-(1,5-dimethylpyrazol-4-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [2-(1,5-dimethylpyrazol-4-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine |
| PubChem CID | 79584800 |
| Molecular Formula | C10H13FN6 |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | [2-(1,5-dimethylpyrazol-4-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(-c2cnn(C)c2C)nc(NN)c1F |
| InChI | InChI=1S/C10H13FN6/c1-5-8(11)10(16-12)15-9(14-5)7-4-13-17(3)6(7)2/h4H,12H2,1-3H3,(H,14,15,16) |
| InChIKey | JYNSPWQWZRAZBA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(1,5-dimethylpyrazol-4-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,5-dimethylpyrazol-4-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine?
The IUPAC name of [2-(1,5-dimethylpyrazol-4-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine (CID 79584800) is [2-(1,5-dimethylpyrazol-4-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine.
What is the SMILES notation for [2-(1,5-dimethylpyrazol-4-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine?
The canonical SMILES for [2-(1,5-dimethylpyrazol-4-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine is Cc1nc(-c2cnn(C)c2C)nc(NN)c1F.
What is the InChIKey of [2-(1,5-dimethylpyrazol-4-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine?
The InChIKey is JYNSPWQWZRAZBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13FN6/c1-5-8(11)10(16-12)15-9(14-5)7-4-13-17(3)6(7)2/h4H,12H2,1-3H3,(H,14,15,16).
What are the key properties of [2-(1,5-dimethylpyrazol-4-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine?
[2-(1,5-dimethylpyrazol-4-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine has a molecular weight of 236.25 g/mol, XLogP of 0.92, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,5-dimethylpyrazol-4-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine is sourced from PubChem (CID 79584800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).