C11H22ClNO3S — CID 79585801
3-chloro-N,2-dimethyl-N-(oxan-4-ylmethyl)propane-1-sulfonamide (PubChem CID 79585801) has the molecular formula C11H22ClNO3S and a molecular weight of 283.82 g/mol. Its IUPAC name is 3-chloro-N,2-dimethyl-N-(oxan-4-ylmethyl)propane-1-sulfonamide.
| Compound Name | 3-chloro-N,2-dimethyl-N-(oxan-4-ylmethyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 79585801 |
| Molecular Formula | C11H22ClNO3S |
| Molecular Weight | 283.82 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 3-chloro-N,2-dimethyl-N-(oxan-4-ylmethyl)propane-1-sulfonamide |
| SMILES | CC(CCl)CS(=O)(=O)N(C)CC1CCOCC1 |
| InChI | InChI=1S/C11H22ClNO3S/c1-10(7-12)9-17(14,15)13(2)8-11-3-5-16-6-4-11/h10-11H,3-9H2,1-2H3 |
| InChIKey | GSRUNGDQJARIFX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.82 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|