C15H22N2O2 — CID 79586482
1-amino-2-[2-(3-methylphenoxy)ethyl]cyclopentane-1-carboxamide (PubChem CID 79586482) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-amino-2-[2-(3-methylphenoxy)ethyl]cyclopentane-1-carboxamide.
| Compound Name | 1-amino-2-[2-(3-methylphenoxy)ethyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 79586482 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-amino-2-[2-(3-methylphenoxy)ethyl]cyclopentane-1-carboxamide |
| SMILES | Cc1cccc(OCCC2CCCC2(N)C(N)=O)c1 |
| InChI | InChI=1S/C15H22N2O2/c1-11-4-2-6-13(10-11)19-9-7-12-5-3-8-15(12,17)14(16)18/h2,4,6,10,12H,3,5,7-9,17H2,1H3,(H2,16,18) |
| InChIKey | ZHXWAHQZCPAABU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |