About 4-(3,3-dimethylmorpholin-4-yl)sulfonyl-3,5-dimethylaniline
4-(3,3-dimethylmorpholin-4-yl)sulfonyl-3,5-dimethylaniline (PubChem CID 79588769) has the molecular formula C14H22N2O3S
and a molecular weight of 298.41 g/mol. Its IUPAC name is 4-(3,3-dimethylmorpholin-4-yl)sulfonyl-3,5-dimethylaniline.
Molecular Properties
| Compound Name | 4-(3,3-dimethylmorpholin-4-yl)sulfonyl-3,5-dimethylaniline |
| PubChem CID | 79588769 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 4-(3,3-dimethylmorpholin-4-yl)sulfonyl-3,5-dimethylaniline |
| SMILES | Cc1cc(N)cc(C)c1S(=O)(=O)N1CCOCC1(C)C |
| InChI | InChI=1S/C14H22N2O3S/c1-10-7-12(15)8-11(2)13(10)20(17,18)16-5-6-19-9-14(16,3)4/h7-8H,5-6,9,15H2,1-4H3 |
| InChIKey | QTVKGAJINVHGIO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,3-dimethylmorpholin-4-yl)sulfonyl-3,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3-dimethylmorpholin-4-yl)sulfonyl-3,5-dimethylaniline?
The IUPAC name of 4-(3,3-dimethylmorpholin-4-yl)sulfonyl-3,5-dimethylaniline (CID 79588769) is 4-(3,3-dimethylmorpholin-4-yl)sulfonyl-3,5-dimethylaniline.
What is the SMILES notation for 4-(3,3-dimethylmorpholin-4-yl)sulfonyl-3,5-dimethylaniline?
The canonical SMILES for 4-(3,3-dimethylmorpholin-4-yl)sulfonyl-3,5-dimethylaniline is Cc1cc(N)cc(C)c1S(=O)(=O)N1CCOCC1(C)C.
What is the InChIKey of 4-(3,3-dimethylmorpholin-4-yl)sulfonyl-3,5-dimethylaniline?
The InChIKey is QTVKGAJINVHGIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O3S/c1-10-7-12(15)8-11(2)13(10)20(17,18)16-5-6-19-9-14(16,3)4/h7-8H,5-6,9,15H2,1-4H3.
What are the key properties of 4-(3,3-dimethylmorpholin-4-yl)sulfonyl-3,5-dimethylaniline?
4-(3,3-dimethylmorpholin-4-yl)sulfonyl-3,5-dimethylaniline has a molecular weight of 298.41 g/mol, XLogP of 1.69, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-dimethylmorpholin-4-yl)sulfonyl-3,5-dimethylaniline is sourced from PubChem (CID 79588769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).