About 3-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-methylpropane-1-sulfonamide
3-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-methylpropane-1-sulfonamide (PubChem CID 79588969) has the molecular formula C8H14ClNO4S2
and a molecular weight of 287.79 g/mol. Its IUPAC name is 3-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-methylpropane-1-sulfonamide.
Molecular Properties
| Compound Name | 3-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-methylpropane-1-sulfonamide |
| PubChem CID | 79588969 |
| Molecular Formula | C8H14ClNO4S2 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 3-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-methylpropane-1-sulfonamide |
| SMILES | CC(CCl)CS(=O)(=O)NC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C8H14ClNO4S2/c1-7(4-9)5-16(13,14)10-8-2-3-15(11,12)6-8/h2-3,7-8,10H,4-6H2,1H3 |
| InChIKey | DEQXBZZYWNFEGG-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-methylpropane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-methylpropane-1-sulfonamide?
The IUPAC name of 3-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-methylpropane-1-sulfonamide (CID 79588969) is 3-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-methylpropane-1-sulfonamide.
What is the SMILES notation for 3-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-methylpropane-1-sulfonamide?
The canonical SMILES for 3-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-methylpropane-1-sulfonamide is CC(CCl)CS(=O)(=O)NC1C=CS(=O)(=O)C1.
What is the InChIKey of 3-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-methylpropane-1-sulfonamide?
The InChIKey is DEQXBZZYWNFEGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14ClNO4S2/c1-7(4-9)5-16(13,14)10-8-2-3-15(11,12)6-8/h2-3,7-8,10H,4-6H2,1H3.
What are the key properties of 3-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-methylpropane-1-sulfonamide?
3-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-methylpropane-1-sulfonamide has a molecular weight of 287.79 g/mol, XLogP of 0.09, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2-methylpropane-1-sulfonamide is sourced from PubChem (CID 79588969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).