About 2-[(4S)-4-methoxypyrrolidin-3-yl]-4-methyl-1,2-thiazolidine 1,1-dioxide
2-[(4S)-4-methoxypyrrolidin-3-yl]-4-methyl-1,2-thiazolidine 1,1-dioxide (PubChem CID 79589586) has the molecular formula C9H18N2O3S
and a molecular weight of 234.32 g/mol. Its IUPAC name is 2-[(4S)-4-methoxypyrrolidin-3-yl]-4-methyl-1,2-thiazolidine 1,1-dioxide.
Molecular Properties
| Compound Name | 2-[(4S)-4-methoxypyrrolidin-3-yl]-4-methyl-1,2-thiazolidine 1,1-dioxide |
| PubChem CID | 79589586 |
| Molecular Formula | C9H18N2O3S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2-[(4S)-4-methoxypyrrolidin-3-yl]-4-methyl-1,2-thiazolidine 1,1-dioxide |
| SMILES | CO[C@H]1CNCC1N1CC(C)CS1(=O)=O |
| InChI | InChI=1S/C9H18N2O3S/c1-7-5-11(15(12,13)6-7)8-3-10-4-9(8)14-2/h7-10H,3-6H2,1-2H3/t7?,8?,9-/m0/s1 |
| InChIKey | ISZJUUYBTQOFSC-HACHORDNSA-N |
| XLogP | -0.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4S)-4-methoxypyrrolidin-3-yl]-4-methyl-1,2-thiazolidine 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4S)-4-methoxypyrrolidin-3-yl]-4-methyl-1,2-thiazolidine 1,1-dioxide?
The IUPAC name of 2-[(4S)-4-methoxypyrrolidin-3-yl]-4-methyl-1,2-thiazolidine 1,1-dioxide (CID 79589586) is 2-[(4S)-4-methoxypyrrolidin-3-yl]-4-methyl-1,2-thiazolidine 1,1-dioxide.
What is the SMILES notation for 2-[(4S)-4-methoxypyrrolidin-3-yl]-4-methyl-1,2-thiazolidine 1,1-dioxide?
The canonical SMILES for 2-[(4S)-4-methoxypyrrolidin-3-yl]-4-methyl-1,2-thiazolidine 1,1-dioxide is CO[C@H]1CNCC1N1CC(C)CS1(=O)=O.
What is the InChIKey of 2-[(4S)-4-methoxypyrrolidin-3-yl]-4-methyl-1,2-thiazolidine 1,1-dioxide?
The InChIKey is ISZJUUYBTQOFSC-HACHORDNSA-N. The full InChI is InChI=1S/C9H18N2O3S/c1-7-5-11(15(12,13)6-7)8-3-10-4-9(8)14-2/h7-10H,3-6H2,1-2H3/t7?,8?,9-/m0/s1.
What are the key properties of 2-[(4S)-4-methoxypyrrolidin-3-yl]-4-methyl-1,2-thiazolidine 1,1-dioxide?
2-[(4S)-4-methoxypyrrolidin-3-yl]-4-methyl-1,2-thiazolidine 1,1-dioxide has a molecular weight of 234.32 g/mol, XLogP of -0.75, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4S)-4-methoxypyrrolidin-3-yl]-4-methyl-1,2-thiazolidine 1,1-dioxide is sourced from PubChem (CID 79589586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).