C12H20BrN3 — CID 79590293
5-(4-bromo-1,3-dimethylpyrazol-5-yl)-N-ethylpent-3-en-1-amine (PubChem CID 79590293) has the molecular formula C12H20BrN3 and a molecular weight of 286.22 g/mol. Its IUPAC name is 5-(4-bromo-1,3-dimethylpyrazol-5-yl)-N-ethylpent-3-en-1-amine.
| Compound Name | 5-(4-bromo-1,3-dimethylpyrazol-5-yl)-N-ethylpent-3-en-1-amine |
|---|---|
| PubChem CID | 79590293 |
| Molecular Formula | C12H20BrN3 |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 5-(4-bromo-1,3-dimethylpyrazol-5-yl)-N-ethylpent-3-en-1-amine |
| SMILES | CCNCCC=CCc1c(Br)c(C)nn1C |
| InChI | InChI=1S/C12H20BrN3/c1-4-14-9-7-5-6-8-11-12(13)10(2)15-16(11)3/h5-6,14H,4,7-9H2,1-3H3 |
| InChIKey | GKSFACTUVOFVAS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|