C17H22N2OS — CID 79590941
2-[1-(methylamino)ethyl]-5-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenol (PubChem CID 79590941) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is 2-[1-(methylamino)ethyl]-5-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenol.
| Compound Name | 2-[1-(methylamino)ethyl]-5-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenol |
|---|---|
| PubChem CID | 79590941 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2-[1-(methylamino)ethyl]-5-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenol |
| SMILES | CNC(C)c1ccc(N2CCc3sccc3C2C)cc1O |
| InChI | InChI=1S/C17H22N2OS/c1-11(18-3)14-5-4-13(10-16(14)20)19-8-6-17-15(12(19)2)7-9-21-17/h4-5,7,9-12,18,20H,6,8H2,1-3H3 |
| InChIKey | HKEBXJMVLQBFOY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|