C18H24N2O — CID 79590960
2-[1-(methylamino)ethyl]-5-(N,3,5-trimethylanilino)phenol (PubChem CID 79590960) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-[1-(methylamino)ethyl]-5-(N,3,5-trimethylanilino)phenol.
| Compound Name | 2-[1-(methylamino)ethyl]-5-(N,3,5-trimethylanilino)phenol |
|---|---|
| PubChem CID | 79590960 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 2-[1-(methylamino)ethyl]-5-(N,3,5-trimethylanilino)phenol |
| SMILES | CNC(C)c1ccc(N(C)c2cc(C)cc(C)c2)cc1O |
| InChI | InChI=1S/C18H24N2O/c1-12-8-13(2)10-16(9-12)20(5)15-6-7-17(14(3)19-4)18(21)11-15/h6-11,14,19,21H,1-5H3 |
| InChIKey | HPYAZYLVFJGZDI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|