About 5-(4,4-diethylpiperidin-1-yl)-2-[1-(methylamino)ethyl]phenol
5-(4,4-diethylpiperidin-1-yl)-2-[1-(methylamino)ethyl]phenol (PubChem CID 79591200) has the molecular formula C18H30N2O
and a molecular weight of 290.45 g/mol. Its IUPAC name is 5-(4,4-diethylpiperidin-1-yl)-2-[1-(methylamino)ethyl]phenol.
Molecular Properties
| Compound Name | 5-(4,4-diethylpiperidin-1-yl)-2-[1-(methylamino)ethyl]phenol |
| PubChem CID | 79591200 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | 5-(4,4-diethylpiperidin-1-yl)-2-[1-(methylamino)ethyl]phenol |
| SMILES | CCC1(CC)CCN(c2ccc(C(C)NC)c(O)c2)CC1 |
| InChI | InChI=1S/C18H30N2O/c1-5-18(6-2)9-11-20(12-10-18)15-7-8-16(14(3)19-4)17(21)13-15/h7-8,13-14,19,21H,5-6,9-12H2,1-4H3 |
| InChIKey | GXQDRFPXKBDWOD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze 5-(4,4-diethylpiperidin-1-yl)-2-[1-(methylamino)ethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,4-diethylpiperidin-1-yl)-2-[1-(methylamino)ethyl]phenol?
The IUPAC name of 5-(4,4-diethylpiperidin-1-yl)-2-[1-(methylamino)ethyl]phenol (CID 79591200) is 5-(4,4-diethylpiperidin-1-yl)-2-[1-(methylamino)ethyl]phenol.
What is the SMILES notation for 5-(4,4-diethylpiperidin-1-yl)-2-[1-(methylamino)ethyl]phenol?
The canonical SMILES for 5-(4,4-diethylpiperidin-1-yl)-2-[1-(methylamino)ethyl]phenol is CCC1(CC)CCN(c2ccc(C(C)NC)c(O)c2)CC1.
What is the InChIKey of 5-(4,4-diethylpiperidin-1-yl)-2-[1-(methylamino)ethyl]phenol?
The InChIKey is GXQDRFPXKBDWOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N2O/c1-5-18(6-2)9-11-20(12-10-18)15-7-8-16(14(3)19-4)17(21)13-15/h7-8,13-14,19,21H,5-6,9-12H2,1-4H3.
What are the key properties of 5-(4,4-diethylpiperidin-1-yl)-2-[1-(methylamino)ethyl]phenol?
5-(4,4-diethylpiperidin-1-yl)-2-[1-(methylamino)ethyl]phenol has a molecular weight of 290.45 g/mol, XLogP of 4.08, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,4-diethylpiperidin-1-yl)-2-[1-(methylamino)ethyl]phenol is sourced from PubChem (CID 79591200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).