About N,6-dimethylhepta-3,5-dien-1-amine
N,6-dimethylhepta-3,5-dien-1-amine (PubChem CID 79592031) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is N,6-dimethylhepta-3,5-dien-1-amine.
Molecular Properties
| Compound Name | N,6-dimethylhepta-3,5-dien-1-amine |
| PubChem CID | 79592031 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | N,6-dimethylhepta-3,5-dien-1-amine |
| SMILES | CNCCC=CC=C(C)C |
| InChI | InChI=1S/C9H17N/c1-9(2)7-5-4-6-8-10-3/h4-5,7,10H,6,8H2,1-3H3 |
| InChIKey | CDLIWUDGIZOPKL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N,6-dimethylhepta-3,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,6-dimethylhepta-3,5-dien-1-amine?
The IUPAC name of N,6-dimethylhepta-3,5-dien-1-amine (CID 79592031) is N,6-dimethylhepta-3,5-dien-1-amine.
What is the SMILES notation for N,6-dimethylhepta-3,5-dien-1-amine?
The canonical SMILES for N,6-dimethylhepta-3,5-dien-1-amine is CNCCC=CC=C(C)C.
What is the InChIKey of N,6-dimethylhepta-3,5-dien-1-amine?
The InChIKey is CDLIWUDGIZOPKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N/c1-9(2)7-5-4-6-8-10-3/h4-5,7,10H,6,8H2,1-3H3.
What are the key properties of N,6-dimethylhepta-3,5-dien-1-amine?
N,6-dimethylhepta-3,5-dien-1-amine has a molecular weight of 139.24 g/mol, XLogP of 2.12, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,6-dimethylhepta-3,5-dien-1-amine is sourced from PubChem (CID 79592031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).