About 4-(5-bromopent-2-en-2-yl)-1,2-dimethylcyclohexane
4-(5-bromopent-2-en-2-yl)-1,2-dimethylcyclohexane (PubChem CID 79593349) has the molecular formula C13H23Br
and a molecular weight of 259.23 g/mol. Its IUPAC name is 4-(5-bromopent-2-en-2-yl)-1,2-dimethylcyclohexane.
Molecular Properties
| Compound Name | 4-(5-bromopent-2-en-2-yl)-1,2-dimethylcyclohexane |
| PubChem CID | 79593349 |
| Molecular Formula | C13H23Br |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 4-(5-bromopent-2-en-2-yl)-1,2-dimethylcyclohexane |
| SMILES | CC(=CCCBr)C1CCC(C)C(C)C1 |
| InChI | InChI=1S/C13H23Br/c1-10-6-7-13(9-12(10)3)11(2)5-4-8-14/h5,10,12-13H,4,6-9H2,1-3H3 |
| InChIKey | ITNPOILLOPMEPL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-bromopent-2-en-2-yl)-1,2-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-bromopent-2-en-2-yl)-1,2-dimethylcyclohexane?
The IUPAC name of 4-(5-bromopent-2-en-2-yl)-1,2-dimethylcyclohexane (CID 79593349) is 4-(5-bromopent-2-en-2-yl)-1,2-dimethylcyclohexane.
What is the SMILES notation for 4-(5-bromopent-2-en-2-yl)-1,2-dimethylcyclohexane?
The canonical SMILES for 4-(5-bromopent-2-en-2-yl)-1,2-dimethylcyclohexane is CC(=CCCBr)C1CCC(C)C(C)C1.
What is the InChIKey of 4-(5-bromopent-2-en-2-yl)-1,2-dimethylcyclohexane?
The InChIKey is ITNPOILLOPMEPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23Br/c1-10-6-7-13(9-12(10)3)11(2)5-4-8-14/h5,10,12-13H,4,6-9H2,1-3H3.
What are the key properties of 4-(5-bromopent-2-en-2-yl)-1,2-dimethylcyclohexane?
4-(5-bromopent-2-en-2-yl)-1,2-dimethylcyclohexane has a molecular weight of 259.23 g/mol, XLogP of 4.79, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-bromopent-2-en-2-yl)-1,2-dimethylcyclohexane is sourced from PubChem (CID 79593349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).