C14H22NO3+ — CID 7959380
(1,3-dihydroxy-2-methylpropan-2-yl)-[(4-prop-2-enoxyphenyl)methyl]azanium (PubChem CID 7959380) has the molecular formula C14H22NO3+ and a molecular weight of 252.33 g/mol. Its IUPAC name is (1,3-dihydroxy-2-methylpropan-2-yl)-[(4-prop-2-enoxyphenyl)methyl]azanium.
| Compound Name | (1,3-dihydroxy-2-methylpropan-2-yl)-[(4-prop-2-enoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7959380 |
| Molecular Formula | C14H22NO3+ |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (1,3-dihydroxy-2-methylpropan-2-yl)-[(4-prop-2-enoxyphenyl)methyl]azanium |
| SMILES | C=CCOc1ccc(C[NH2+]C(C)(CO)CO)cc1 |
| InChI | InChI=1S/C14H21NO3/c1-3-8-18-13-6-4-12(5-7-13)9-15-14(2,10-16)11-17/h3-7,15-17H,1,8-11H2,2H3/p+1 |
| InChIKey | AFZBYNADQSJXQH-UHFFFAOYSA-O |
| XLogP | 0.06 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|