C18H20BrCl — CID 79594151
1-bromo-4-[chloro-(2,2,3,3-tetramethylcyclopropyl)methyl]naphthalene (PubChem CID 79594151) has the molecular formula C18H20BrCl and a molecular weight of 351.72 g/mol. Its IUPAC name is 1-bromo-4-[chloro-(2,2,3,3-tetramethylcyclopropyl)methyl]naphthalene.
| Compound Name | 1-bromo-4-[chloro-(2,2,3,3-tetramethylcyclopropyl)methyl]naphthalene |
|---|---|
| PubChem CID | 79594151 |
| Molecular Formula | C18H20BrCl |
| Molecular Weight | 351.72 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 1-bromo-4-[chloro-(2,2,3,3-tetramethylcyclopropyl)methyl]naphthalene |
| SMILES | CC1(C)C(C(Cl)c2ccc(Br)c3ccccc23)C1(C)C |
| InChI | InChI=1S/C18H20BrCl/c1-17(2)16(18(17,3)4)15(20)13-9-10-14(19)12-8-6-5-7-11(12)13/h5-10,15-16H,1-4H3 |
| InChIKey | WGMKSZFXSFPSDM-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.72 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|