About [1-(aminomethyl)-2,3-dihydroinden-1-yl]-(1,5-dimethylpyrazol-4-yl)methanol
[1-(aminomethyl)-2,3-dihydroinden-1-yl]-(1,5-dimethylpyrazol-4-yl)methanol (PubChem CID 79595903) has the molecular formula C16H21N3O
and a molecular weight of 271.36 g/mol. Its IUPAC name is [1-(aminomethyl)-2,3-dihydroinden-1-yl]-(1,5-dimethylpyrazol-4-yl)methanol.
Molecular Properties
| Compound Name | [1-(aminomethyl)-2,3-dihydroinden-1-yl]-(1,5-dimethylpyrazol-4-yl)methanol |
| PubChem CID | 79595903 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | [1-(aminomethyl)-2,3-dihydroinden-1-yl]-(1,5-dimethylpyrazol-4-yl)methanol |
| SMILES | Cc1c(C(O)C2(CN)CCc3ccccc32)cnn1C |
| InChI | InChI=1S/C16H21N3O/c1-11-13(9-18-19(11)2)15(20)16(10-17)8-7-12-5-3-4-6-14(12)16/h3-6,9,15,20H,7-8,10,17H2,1-2H3 |
| InChIKey | YZTIPQDTODEGCU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(aminomethyl)-2,3-dihydroinden-1-yl]-(1,5-dimethylpyrazol-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(aminomethyl)-2,3-dihydroinden-1-yl]-(1,5-dimethylpyrazol-4-yl)methanol?
The IUPAC name of [1-(aminomethyl)-2,3-dihydroinden-1-yl]-(1,5-dimethylpyrazol-4-yl)methanol (CID 79595903) is [1-(aminomethyl)-2,3-dihydroinden-1-yl]-(1,5-dimethylpyrazol-4-yl)methanol.
What is the SMILES notation for [1-(aminomethyl)-2,3-dihydroinden-1-yl]-(1,5-dimethylpyrazol-4-yl)methanol?
The canonical SMILES for [1-(aminomethyl)-2,3-dihydroinden-1-yl]-(1,5-dimethylpyrazol-4-yl)methanol is Cc1c(C(O)C2(CN)CCc3ccccc32)cnn1C.
What is the InChIKey of [1-(aminomethyl)-2,3-dihydroinden-1-yl]-(1,5-dimethylpyrazol-4-yl)methanol?
The InChIKey is YZTIPQDTODEGCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O/c1-11-13(9-18-19(11)2)15(20)16(10-17)8-7-12-5-3-4-6-14(12)16/h3-6,9,15,20H,7-8,10,17H2,1-2H3.
What are the key properties of [1-(aminomethyl)-2,3-dihydroinden-1-yl]-(1,5-dimethylpyrazol-4-yl)methanol?
[1-(aminomethyl)-2,3-dihydroinden-1-yl]-(1,5-dimethylpyrazol-4-yl)methanol has a molecular weight of 271.36 g/mol, XLogP of 1.60, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(aminomethyl)-2,3-dihydroinden-1-yl]-(1,5-dimethylpyrazol-4-yl)methanol is sourced from PubChem (CID 79595903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).