C14H14ClN — CID 79597194
9-chloro-1,2,3,4-tetrahydrophenanthren-1-amine (PubChem CID 79597194) has the molecular formula C14H14ClN and a molecular weight of 231.73 g/mol. Its IUPAC name is 9-chloro-1,2,3,4-tetrahydrophenanthren-1-amine.
| Compound Name | 9-chloro-1,2,3,4-tetrahydrophenanthren-1-amine |
|---|---|
| PubChem CID | 79597194 |
| Molecular Formula | C14H14ClN |
| Molecular Weight | 231.73 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 9-chloro-1,2,3,4-tetrahydrophenanthren-1-amine |
| SMILES | NC1CCCc2c1cc(Cl)c1ccccc21 |
| InChI | InChI=1S/C14H14ClN/c15-13-8-12-10(6-3-7-14(12)16)9-4-1-2-5-11(9)13/h1-2,4-5,8,14H,3,6-7,16H2 |
| InChIKey | WUCGYNNPSJVBOY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.73 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |