About 4-[[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]methyl]oxan-4-ol
4-[[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]methyl]oxan-4-ol (PubChem CID 79597453) has the molecular formula C13H17BrN4O2
and a molecular weight of 341.21 g/mol. Its IUPAC name is 4-[[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]methyl]oxan-4-ol.
Molecular Properties
| Compound Name | 4-[[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]methyl]oxan-4-ol |
| PubChem CID | 79597453 |
| Molecular Formula | C13H17BrN4O2 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 4-[[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]methyl]oxan-4-ol |
| SMILES | OC1(CNCc2cnc3cnc(Br)cn23)CCOCC1 |
| InChI | InChI=1S/C13H17BrN4O2/c14-11-8-18-10(6-17-12(18)7-16-11)5-15-9-13(19)1-3-20-4-2-13/h6-8,15,19H,1-5,9H2 |
| InChIKey | XFZQFGLDRKJNKQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]methyl]oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]methyl]oxan-4-ol?
The IUPAC name of 4-[[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]methyl]oxan-4-ol (CID 79597453) is 4-[[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]methyl]oxan-4-ol.
What is the SMILES notation for 4-[[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]methyl]oxan-4-ol?
The canonical SMILES for 4-[[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]methyl]oxan-4-ol is OC1(CNCc2cnc3cnc(Br)cn23)CCOCC1.
What is the InChIKey of 4-[[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]methyl]oxan-4-ol?
The InChIKey is XFZQFGLDRKJNKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17BrN4O2/c14-11-8-18-10(6-17-12(18)7-16-11)5-15-9-13(19)1-3-20-4-2-13/h6-8,15,19H,1-5,9H2.
What are the key properties of 4-[[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]methyl]oxan-4-ol?
4-[[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]methyl]oxan-4-ol has a molecular weight of 341.21 g/mol, XLogP of 1.12, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]methyl]oxan-4-ol is sourced from PubChem (CID 79597453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).