About 5-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-6-fluoro-1H-benzimidazole
5-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-6-fluoro-1H-benzimidazole (PubChem CID 79598177) has the molecular formula C15H10BrFN2O
and a molecular weight of 333.16 g/mol. Its IUPAC name is 5-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-6-fluoro-1H-benzimidazole.
Molecular Properties
| Compound Name | 5-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-6-fluoro-1H-benzimidazole |
| PubChem CID | 79598177 |
| Molecular Formula | C15H10BrFN2O |
| Molecular Weight | 333.16 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 5-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-6-fluoro-1H-benzimidazole |
| SMILES | Fc1cc2[nH]c(-c3ccc4c(c3)COC4)nc2cc1Br |
| InChI | InChI=1S/C15H10BrFN2O/c16-11-4-13-14(5-12(11)17)19-15(18-13)8-1-2-9-6-20-7-10(9)3-8/h1-5H,6-7H2,(H,18,19) |
| InChIKey | HGJYURUOWRWMPR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.16 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-6-fluoro-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-6-fluoro-1H-benzimidazole?
The IUPAC name of 5-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-6-fluoro-1H-benzimidazole (CID 79598177) is 5-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-6-fluoro-1H-benzimidazole.
What is the SMILES notation for 5-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-6-fluoro-1H-benzimidazole?
The canonical SMILES for 5-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-6-fluoro-1H-benzimidazole is Fc1cc2[nH]c(-c3ccc4c(c3)COC4)nc2cc1Br.
What is the InChIKey of 5-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-6-fluoro-1H-benzimidazole?
The InChIKey is HGJYURUOWRWMPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BrFN2O/c16-11-4-13-14(5-12(11)17)19-15(18-13)8-1-2-9-6-20-7-10(9)3-8/h1-5H,6-7H2,(H,18,19).
What are the key properties of 5-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-6-fluoro-1H-benzimidazole?
5-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-6-fluoro-1H-benzimidazole has a molecular weight of 333.16 g/mol, XLogP of 4.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-6-fluoro-1H-benzimidazole is sourced from PubChem (CID 79598177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).