C15H23N — CID 79599356
N-ethyl-4-methyl-5-(2-methylphenyl)pent-3-en-1-amine (PubChem CID 79599356) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is N-ethyl-4-methyl-5-(2-methylphenyl)pent-3-en-1-amine.
| Compound Name | N-ethyl-4-methyl-5-(2-methylphenyl)pent-3-en-1-amine |
|---|---|
| PubChem CID | 79599356 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | N-ethyl-4-methyl-5-(2-methylphenyl)pent-3-en-1-amine |
| SMILES | CCNCCC=C(C)Cc1ccccc1C |
| InChI | InChI=1S/C15H23N/c1-4-16-11-7-8-13(2)12-15-10-6-5-9-14(15)3/h5-6,8-10,16H,4,7,11-12H2,1-3H3 |
| InChIKey | GNOBSOSREQBZHI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|