C15H22FNO — CID 79599741
N-ethyl-5-(3-fluoro-4-methoxyphenyl)-4-methylpent-3-en-1-amine (PubChem CID 79599741) has the molecular formula C15H22FNO and a molecular weight of 251.34 g/mol. Its IUPAC name is N-ethyl-5-(3-fluoro-4-methoxyphenyl)-4-methylpent-3-en-1-amine.
| Compound Name | N-ethyl-5-(3-fluoro-4-methoxyphenyl)-4-methylpent-3-en-1-amine |
|---|---|
| PubChem CID | 79599741 |
| Molecular Formula | C15H22FNO |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | N-ethyl-5-(3-fluoro-4-methoxyphenyl)-4-methylpent-3-en-1-amine |
| SMILES | CCNCCC=C(C)Cc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C15H22FNO/c1-4-17-9-5-6-12(2)10-13-7-8-15(18-3)14(16)11-13/h6-8,11,17H,4-5,9-10H2,1-3H3 |
| InChIKey | VAJZMMSPQHALRO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|