C9H21N3O3S — CID 79600077
2-[ethyl(2-propan-2-yloxyethylsulfonyl)amino]ethanimidamide (PubChem CID 79600077) has the molecular formula C9H21N3O3S and a molecular weight of 251.35 g/mol. Its IUPAC name is 2-[ethyl(2-propan-2-yloxyethylsulfonyl)amino]ethanimidamide.
| Compound Name | 2-[ethyl(2-propan-2-yloxyethylsulfonyl)amino]ethanimidamide |
|---|---|
| PubChem CID | 79600077 |
| Molecular Formula | C9H21N3O3S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-[ethyl(2-propan-2-yloxyethylsulfonyl)amino]ethanimidamide |
| SMILES | [H]/N=C(\N)CN(CC)S(=O)(=O)CCOC(C)C |
| InChI | InChI=1S/C9H21N3O3S/c1-4-12(7-9(10)11)16(13,14)6-5-15-8(2)3/h8H,4-7H2,1-3H3,(H3,10,11) |
| InChIKey | IQWCTVALONVVFI-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 96.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|