About [5-(propan-2-ylsulfanylmethyl)-1H-1,2,4-triazol-3-yl]methanol
[5-(propan-2-ylsulfanylmethyl)-1H-1,2,4-triazol-3-yl]methanol (PubChem CID 79600169) has the molecular formula C7H13N3OS
and a molecular weight of 187.27 g/mol. Its IUPAC name is [5-(propan-2-ylsulfanylmethyl)-1H-1,2,4-triazol-3-yl]methanol.
Molecular Properties
| Compound Name | [5-(propan-2-ylsulfanylmethyl)-1H-1,2,4-triazol-3-yl]methanol |
| PubChem CID | 79600169 |
| Molecular Formula | C7H13N3OS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | [5-(propan-2-ylsulfanylmethyl)-1H-1,2,4-triazol-3-yl]methanol |
| SMILES | CC(C)SCc1nc(CO)n[nH]1 |
| InChI | InChI=1S/C7H13N3OS/c1-5(2)12-4-7-8-6(3-11)9-10-7/h5,11H,3-4H2,1-2H3,(H,8,9,10) |
| InChIKey | KYZLSANADZACMT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(propan-2-ylsulfanylmethyl)-1H-1,2,4-triazol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(propan-2-ylsulfanylmethyl)-1H-1,2,4-triazol-3-yl]methanol?
The IUPAC name of [5-(propan-2-ylsulfanylmethyl)-1H-1,2,4-triazol-3-yl]methanol (CID 79600169) is [5-(propan-2-ylsulfanylmethyl)-1H-1,2,4-triazol-3-yl]methanol.
What is the SMILES notation for [5-(propan-2-ylsulfanylmethyl)-1H-1,2,4-triazol-3-yl]methanol?
The canonical SMILES for [5-(propan-2-ylsulfanylmethyl)-1H-1,2,4-triazol-3-yl]methanol is CC(C)SCc1nc(CO)n[nH]1.
What is the InChIKey of [5-(propan-2-ylsulfanylmethyl)-1H-1,2,4-triazol-3-yl]methanol?
The InChIKey is KYZLSANADZACMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3OS/c1-5(2)12-4-7-8-6(3-11)9-10-7/h5,11H,3-4H2,1-2H3,(H,8,9,10).
What are the key properties of [5-(propan-2-ylsulfanylmethyl)-1H-1,2,4-triazol-3-yl]methanol?
[5-(propan-2-ylsulfanylmethyl)-1H-1,2,4-triazol-3-yl]methanol has a molecular weight of 187.27 g/mol, XLogP of 0.94, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(propan-2-ylsulfanylmethyl)-1H-1,2,4-triazol-3-yl]methanol is sourced from PubChem (CID 79600169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).