C11H13N3O2 — CID 79600800
[5-[(4-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]methanol (PubChem CID 79600800) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is [5-[(4-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]methanol.
| Compound Name | [5-[(4-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 79600800 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | [5-[(4-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]methanol |
| SMILES | COc1ccc(Cc2nc(CO)n[nH]2)cc1 |
| InChI | InChI=1S/C11H13N3O2/c1-16-9-4-2-8(3-5-9)6-10-12-11(7-15)14-13-10/h2-5,15H,6-7H2,1H3,(H,12,13,14) |
| InChIKey | NPTSKFOZJYLAEV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |