About [3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]methanol
[3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]methanol (PubChem CID 79600891) has the molecular formula C9H8FN3O
and a molecular weight of 193.18 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]methanol.
Molecular Properties
| Compound Name | [3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]methanol |
| PubChem CID | 79600891 |
| Molecular Formula | C9H8FN3O |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | [3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]methanol |
| SMILES | OCc1nc(-c2ccc(F)cc2)n[nH]1 |
| InChI | InChI=1S/C9H8FN3O/c10-7-3-1-6(2-4-7)9-11-8(5-14)12-13-9/h1-4,14H,5H2,(H,11,12,13) |
| InChIKey | ATBKKQCFWRWVBP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]methanol?
The IUPAC name of [3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]methanol (CID 79600891) is [3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]methanol.
What is the SMILES notation for [3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]methanol?
The canonical SMILES for [3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]methanol is OCc1nc(-c2ccc(F)cc2)n[nH]1.
What is the InChIKey of [3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]methanol?
The InChIKey is ATBKKQCFWRWVBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FN3O/c10-7-3-1-6(2-4-7)9-11-8(5-14)12-13-9/h1-4,14H,5H2,(H,11,12,13).
What are the key properties of [3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]methanol?
[3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]methanol has a molecular weight of 193.18 g/mol, XLogP of 1.10, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]methanol is sourced from PubChem (CID 79600891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).