About N-[(7-methyl-1,3-benzoxazol-2-yl)methyl]aniline
N-[(7-methyl-1,3-benzoxazol-2-yl)methyl]aniline (PubChem CID 79601457) has the molecular formula C15H14N2O
and a molecular weight of 238.29 g/mol. Its IUPAC name is N-[(7-methyl-1,3-benzoxazol-2-yl)methyl]aniline.
Molecular Properties
| Compound Name | N-[(7-methyl-1,3-benzoxazol-2-yl)methyl]aniline |
| PubChem CID | 79601457 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | N-[(7-methyl-1,3-benzoxazol-2-yl)methyl]aniline |
| SMILES | Cc1cccc2nc(CNc3ccccc3)oc12 |
| InChI | InChI=1S/C15H14N2O/c1-11-6-5-9-13-15(11)18-14(17-13)10-16-12-7-3-2-4-8-12/h2-9,16H,10H2,1H3 |
| InChIKey | UAWKUWQXEAAEDJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(7-methyl-1,3-benzoxazol-2-yl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(7-methyl-1,3-benzoxazol-2-yl)methyl]aniline?
The IUPAC name of N-[(7-methyl-1,3-benzoxazol-2-yl)methyl]aniline (CID 79601457) is N-[(7-methyl-1,3-benzoxazol-2-yl)methyl]aniline.
What is the SMILES notation for N-[(7-methyl-1,3-benzoxazol-2-yl)methyl]aniline?
The canonical SMILES for N-[(7-methyl-1,3-benzoxazol-2-yl)methyl]aniline is Cc1cccc2nc(CNc3ccccc3)oc12.
What is the InChIKey of N-[(7-methyl-1,3-benzoxazol-2-yl)methyl]aniline?
The InChIKey is UAWKUWQXEAAEDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O/c1-11-6-5-9-13-15(11)18-14(17-13)10-16-12-7-3-2-4-8-12/h2-9,16H,10H2,1H3.
What are the key properties of N-[(7-methyl-1,3-benzoxazol-2-yl)methyl]aniline?
N-[(7-methyl-1,3-benzoxazol-2-yl)methyl]aniline has a molecular weight of 238.29 g/mol, XLogP of 3.75, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(7-methyl-1,3-benzoxazol-2-yl)methyl]aniline is sourced from PubChem (CID 79601457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).