About [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate
[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate (PubChem CID 7960162) has the molecular formula C17H15N3O4S
and a molecular weight of 357.39 g/mol. Its IUPAC name is [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate.
Molecular Properties
| Compound Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate |
| PubChem CID | 7960162 |
| Molecular Formula | C17H15N3O4S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate |
| SMILES | NC(=O)c1ccsc1NC(=O)COC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H15N3O4S/c18-16(23)12-5-6-25-17(12)20-14(21)9-24-15(22)7-10-8-19-13-4-2-1-3-11(10)13/h1-6,8,19H,7,9H2,(H2,18,23)(H,20,21) |
| InChIKey | ZCPMDMZZWWHGEQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 114.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate?
The IUPAC name of [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate (CID 7960162) is [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate.
What is the SMILES notation for [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate?
The canonical SMILES for [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate is NC(=O)c1ccsc1NC(=O)COC(=O)Cc1c[nH]c2ccccc12.
What is the InChIKey of [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate?
The InChIKey is ZCPMDMZZWWHGEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O4S/c18-16(23)12-5-6-25-17(12)20-14(21)9-24-15(22)7-10-8-19-13-4-2-1-3-11(10)13/h1-6,8,19H,7,9H2,(H2,18,23)(H,20,21).
What are the key properties of [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate?
[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate has a molecular weight of 357.39 g/mol, XLogP of 2.05, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate is sourced from PubChem (CID 7960162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).