About 2-(4-bromobut-1-enyl)-1,4-difluorobenzene
2-(4-bromobut-1-enyl)-1,4-difluorobenzene (PubChem CID 79603526) has the molecular formula C10H9BrF2
and a molecular weight of 247.08 g/mol. Its IUPAC name is 2-(4-bromobut-1-enyl)-1,4-difluorobenzene.
Molecular Properties
| Compound Name | 2-(4-bromobut-1-enyl)-1,4-difluorobenzene |
| PubChem CID | 79603526 |
| Molecular Formula | C10H9BrF2 |
| Molecular Weight | 247.08 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | 2-(4-bromobut-1-enyl)-1,4-difluorobenzene |
| SMILES | Fc1ccc(F)c(C=CCCBr)c1 |
| InChI | InChI=1S/C10H9BrF2/c11-6-2-1-3-8-7-9(12)4-5-10(8)13/h1,3-5,7H,2,6H2 |
| InChIKey | ZFUIRDIHMQOLRI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.08 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromobut-1-enyl)-1,4-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromobut-1-enyl)-1,4-difluorobenzene?
The IUPAC name of 2-(4-bromobut-1-enyl)-1,4-difluorobenzene (CID 79603526) is 2-(4-bromobut-1-enyl)-1,4-difluorobenzene.
What is the SMILES notation for 2-(4-bromobut-1-enyl)-1,4-difluorobenzene?
The canonical SMILES for 2-(4-bromobut-1-enyl)-1,4-difluorobenzene is Fc1ccc(F)c(C=CCCBr)c1.
What is the InChIKey of 2-(4-bromobut-1-enyl)-1,4-difluorobenzene?
The InChIKey is ZFUIRDIHMQOLRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrF2/c11-6-2-1-3-8-7-9(12)4-5-10(8)13/h1,3-5,7H,2,6H2.
What are the key properties of 2-(4-bromobut-1-enyl)-1,4-difluorobenzene?
2-(4-bromobut-1-enyl)-1,4-difluorobenzene has a molecular weight of 247.08 g/mol, XLogP of 3.76, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromobut-1-enyl)-1,4-difluorobenzene is sourced from PubChem (CID 79603526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).