C13H21F3N2O — CID 79604273
N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 79604273) has the molecular formula C13H21F3N2O and a molecular weight of 278.32 g/mol. Its IUPAC name is N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 79604273 |
| Molecular Formula | C13H21F3N2O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | CCn1c(C)cc(CNCCOCC(F)(F)F)c1C |
| InChI | InChI=1S/C13H21F3N2O/c1-4-18-10(2)7-12(11(18)3)8-17-5-6-19-9-13(14,15)16/h7,17H,4-6,8-9H2,1-3H3 |
| InChIKey | PIWZOMZDRTYIKW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|