C12H19N3O3S — CID 79604536
3-[(1-methylsulfonylpiperidin-3-yl)methoxy]pyridin-2-amine (PubChem CID 79604536) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is 3-[(1-methylsulfonylpiperidin-3-yl)methoxy]pyridin-2-amine.
| Compound Name | 3-[(1-methylsulfonylpiperidin-3-yl)methoxy]pyridin-2-amine |
|---|---|
| PubChem CID | 79604536 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 3-[(1-methylsulfonylpiperidin-3-yl)methoxy]pyridin-2-amine |
| SMILES | CS(=O)(=O)N1CCCC(COc2cccnc2N)C1 |
| InChI | InChI=1S/C12H19N3O3S/c1-19(16,17)15-7-3-4-10(8-15)9-18-11-5-2-6-14-12(11)13/h2,5-6,10H,3-4,7-9H2,1H3,(H2,13,14) |
| InChIKey | XQHCGVYMKWIBNZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |