C15H29N3 — CID 79605149
N',N'-diethyl-N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]ethane-1,2-diamine (PubChem CID 79605149) has the molecular formula C15H29N3 and a molecular weight of 251.42 g/mol. Its IUPAC name is N',N'-diethyl-N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 79605149 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | N',N'-diethyl-N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]ethane-1,2-diamine |
| SMILES | CCN(CC)CCNCc1cc(C)n(CC)c1C |
| InChI | InChI=1S/C15H29N3/c1-6-17(7-2)10-9-16-12-15-11-13(4)18(8-3)14(15)5/h11,16H,6-10,12H2,1-5H3 |
| InChIKey | HHLIPEZLLBTYED-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|