About 5-[[2-(4-methyl-1,2,4-triazol-3-yl)anilino]methyl]thiophene-3-carbonitrile
5-[[2-(4-methyl-1,2,4-triazol-3-yl)anilino]methyl]thiophene-3-carbonitrile (PubChem CID 79611378) has the molecular formula C15H13N5S
and a molecular weight of 295.37 g/mol. Its IUPAC name is 5-[[2-(4-methyl-1,2,4-triazol-3-yl)anilino]methyl]thiophene-3-carbonitrile.
Molecular Properties
| Compound Name | 5-[[2-(4-methyl-1,2,4-triazol-3-yl)anilino]methyl]thiophene-3-carbonitrile |
| PubChem CID | 79611378 |
| Molecular Formula | C15H13N5S |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 5-[[2-(4-methyl-1,2,4-triazol-3-yl)anilino]methyl]thiophene-3-carbonitrile |
| SMILES | Cn1cnnc1-c1ccccc1NCc1cc(C#N)cs1 |
| InChI | InChI=1S/C15H13N5S/c1-20-10-18-19-15(20)13-4-2-3-5-14(13)17-8-12-6-11(7-16)9-21-12/h2-6,9-10,17H,8H2,1H3 |
| InChIKey | DSLGCCHOECKJDV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[[2-(4-methyl-1,2,4-triazol-3-yl)anilino]methyl]thiophene-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[2-(4-methyl-1,2,4-triazol-3-yl)anilino]methyl]thiophene-3-carbonitrile?
The IUPAC name of 5-[[2-(4-methyl-1,2,4-triazol-3-yl)anilino]methyl]thiophene-3-carbonitrile (CID 79611378) is 5-[[2-(4-methyl-1,2,4-triazol-3-yl)anilino]methyl]thiophene-3-carbonitrile.
What is the SMILES notation for 5-[[2-(4-methyl-1,2,4-triazol-3-yl)anilino]methyl]thiophene-3-carbonitrile?
The canonical SMILES for 5-[[2-(4-methyl-1,2,4-triazol-3-yl)anilino]methyl]thiophene-3-carbonitrile is Cn1cnnc1-c1ccccc1NCc1cc(C#N)cs1.
What is the InChIKey of 5-[[2-(4-methyl-1,2,4-triazol-3-yl)anilino]methyl]thiophene-3-carbonitrile?
The InChIKey is DSLGCCHOECKJDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N5S/c1-20-10-18-19-15(20)13-4-2-3-5-14(13)17-8-12-6-11(7-16)9-21-12/h2-6,9-10,17H,8H2,1H3.
What are the key properties of 5-[[2-(4-methyl-1,2,4-triazol-3-yl)anilino]methyl]thiophene-3-carbonitrile?
5-[[2-(4-methyl-1,2,4-triazol-3-yl)anilino]methyl]thiophene-3-carbonitrile has a molecular weight of 295.37 g/mol, XLogP of 3.03, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[2-(4-methyl-1,2,4-triazol-3-yl)anilino]methyl]thiophene-3-carbonitrile is sourced from PubChem (CID 79611378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).