About 5-[[(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]methyl]thiophene-3-carboxamide
5-[[(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]methyl]thiophene-3-carboxamide (PubChem CID 79611980) has the molecular formula C13H11BrN4O2S
and a molecular weight of 367.23 g/mol. Its IUPAC name is 5-[[(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]methyl]thiophene-3-carboxamide.
Molecular Properties
| Compound Name | 5-[[(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]methyl]thiophene-3-carboxamide |
| PubChem CID | 79611980 |
| Molecular Formula | C13H11BrN4O2S |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | 5-[[(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]methyl]thiophene-3-carboxamide |
| SMILES | NC(=O)c1csc(CNc2cc3[nH]c(=O)[nH]c3cc2Br)c1 |
| InChI | InChI=1S/C13H11BrN4O2S/c14-8-2-10-11(18-13(20)17-10)3-9(8)16-4-7-1-6(5-21-7)12(15)19/h1-3,5,16H,4H2,(H2,15,19)(H2,17,18,20) |
| InChIKey | QULDQHYSJODRTE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]methyl]thiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]methyl]thiophene-3-carboxamide?
The IUPAC name of 5-[[(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]methyl]thiophene-3-carboxamide (CID 79611980) is 5-[[(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]methyl]thiophene-3-carboxamide.
What is the SMILES notation for 5-[[(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]methyl]thiophene-3-carboxamide?
The canonical SMILES for 5-[[(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]methyl]thiophene-3-carboxamide is NC(=O)c1csc(CNc2cc3[nH]c(=O)[nH]c3cc2Br)c1.
What is the InChIKey of 5-[[(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]methyl]thiophene-3-carboxamide?
The InChIKey is QULDQHYSJODRTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrN4O2S/c14-8-2-10-11(18-13(20)17-10)3-9(8)16-4-7-1-6(5-21-7)12(15)19/h1-3,5,16H,4H2,(H2,15,19)(H2,17,18,20).
What are the key properties of 5-[[(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]methyl]thiophene-3-carboxamide?
5-[[(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]methyl]thiophene-3-carboxamide has a molecular weight of 367.23 g/mol, XLogP of 2.39, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(6-bromo-2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]methyl]thiophene-3-carboxamide is sourced from PubChem (CID 79611980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).