About N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine
N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 79612022) has the molecular formula C19H30N2
and a molecular weight of 286.46 g/mol. Its IUPAC name is N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine.
Molecular Properties
| Compound Name | N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine |
| PubChem CID | 79612022 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | CCn1c(C)cc(CNC2CC3CC2C2CCCC32)c1C |
| InChI | InChI=1S/C19H30N2/c1-4-21-12(2)8-15(13(21)3)11-20-19-10-14-9-18(19)17-7-5-6-16(14)17/h8,14,16-20H,4-7,9-11H2,1-3H3 |
| InChIKey | ZWERREYKPYHVBH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine?
The IUPAC name of N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine (CID 79612022) is N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine.
What is the SMILES notation for N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine?
The canonical SMILES for N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine is CCn1c(C)cc(CNC2CC3CC2C2CCCC32)c1C.
What is the InChIKey of N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine?
The InChIKey is ZWERREYKPYHVBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2/c1-4-21-12(2)8-15(13(21)3)11-20-19-10-14-9-18(19)17-7-5-6-16(14)17/h8,14,16-20H,4-7,9-11H2,1-3H3.
What are the key properties of N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine?
N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine has a molecular weight of 286.46 g/mol, XLogP of 4.04, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]tricyclo[5.2.1.02,6]decan-8-amine is sourced from PubChem (CID 79612022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).