C15H24N2O4 — CID 79613001
2-[8-(4-amino-3-methyloxolane-3-carbonyl)-8-azabicyclo[3.2.1]octan-3-yl]acetic acid (PubChem CID 79613001) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-[8-(4-amino-3-methyloxolane-3-carbonyl)-8-azabicyclo[3.2.1]octan-3-yl]acetic acid.
| Compound Name | 2-[8-(4-amino-3-methyloxolane-3-carbonyl)-8-azabicyclo[3.2.1]octan-3-yl]acetic acid |
|---|---|
| PubChem CID | 79613001 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-[8-(4-amino-3-methyloxolane-3-carbonyl)-8-azabicyclo[3.2.1]octan-3-yl]acetic acid |
| SMILES | CC1(C(=O)N2C3CCC2CC(CC(=O)O)C3)COCC1N |
| InChI | InChI=1S/C15H24N2O4/c1-15(8-21-7-12(15)16)14(20)17-10-2-3-11(17)5-9(4-10)6-13(18)19/h9-12H,2-8,16H2,1H3,(H,18,19) |
| InChIKey | KQWULROWXLRMJQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |