C13H13N3O2S2 — CID 79613516
3-[(4-cyanothiophen-2-yl)methylamino]-4-methylbenzenesulfonamide (PubChem CID 79613516) has the molecular formula C13H13N3O2S2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 3-[(4-cyanothiophen-2-yl)methylamino]-4-methylbenzenesulfonamide.
| Compound Name | 3-[(4-cyanothiophen-2-yl)methylamino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 79613516 |
| Molecular Formula | C13H13N3O2S2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 3-[(4-cyanothiophen-2-yl)methylamino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1NCc1cc(C#N)cs1 |
| InChI | InChI=1S/C13H13N3O2S2/c1-9-2-3-12(20(15,17)18)5-13(9)16-7-11-4-10(6-14)8-19-11/h2-5,8,16H,7H2,1H3,(H2,15,17,18) |
| InChIKey | GVGRGLOKGZENBP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |