C9H8N4S — CID 79613746
5-[(1H-pyrazol-4-ylamino)methyl]thiophene-3-carbonitrile (PubChem CID 79613746) has the molecular formula C9H8N4S and a molecular weight of 204.26 g/mol. Its IUPAC name is 5-[(1H-pyrazol-4-ylamino)methyl]thiophene-3-carbonitrile.
| Compound Name | 5-[(1H-pyrazol-4-ylamino)methyl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 79613746 |
| Molecular Formula | C9H8N4S |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 5-[(1H-pyrazol-4-ylamino)methyl]thiophene-3-carbonitrile |
| SMILES | N#Cc1csc(CNc2cn[nH]c2)c1 |
| InChI | InChI=1S/C9H8N4S/c10-2-7-1-9(14-6-7)5-11-8-3-12-13-4-8/h1,3-4,6,11H,5H2,(H,12,13) |
| InChIKey | CDQOFMFJHWKPAG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |