About 5-[[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]methyl]thiophene-3-carbonitrile
5-[[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]methyl]thiophene-3-carbonitrile (PubChem CID 79614476) has the molecular formula C12H7ClN4S2
and a molecular weight of 306.80 g/mol. Its IUPAC name is 5-[[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]methyl]thiophene-3-carbonitrile.
Molecular Properties
| Compound Name | 5-[[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]methyl]thiophene-3-carbonitrile |
| PubChem CID | 79614476 |
| Molecular Formula | C12H7ClN4S2 |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | 5-[[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]methyl]thiophene-3-carbonitrile |
| SMILES | N#Cc1csc(CNc2c(Cl)ccc3nsnc23)c1 |
| InChI | InChI=1S/C12H7ClN4S2/c13-9-1-2-10-12(17-19-16-10)11(9)15-5-8-3-7(4-14)6-18-8/h1-3,6,15H,5H2 |
| InChIKey | XPKFOGUXKYWTEJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]methyl]thiophene-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]methyl]thiophene-3-carbonitrile?
The IUPAC name of 5-[[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]methyl]thiophene-3-carbonitrile (CID 79614476) is 5-[[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]methyl]thiophene-3-carbonitrile.
What is the SMILES notation for 5-[[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]methyl]thiophene-3-carbonitrile?
The canonical SMILES for 5-[[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]methyl]thiophene-3-carbonitrile is N#Cc1csc(CNc2c(Cl)ccc3nsnc23)c1.
What is the InChIKey of 5-[[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]methyl]thiophene-3-carbonitrile?
The InChIKey is XPKFOGUXKYWTEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7ClN4S2/c13-9-1-2-10-12(17-19-16-10)11(9)15-5-8-3-7(4-14)6-18-8/h1-3,6,15H,5H2.
What are the key properties of 5-[[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]methyl]thiophene-3-carbonitrile?
5-[[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]methyl]thiophene-3-carbonitrile has a molecular weight of 306.80 g/mol, XLogP of 3.89, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]methyl]thiophene-3-carbonitrile is sourced from PubChem (CID 79614476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).