C11H17N3O2S — CID 79614506
5-[[[1-(ethylamino)-1-oxopropan-2-yl]amino]methyl]thiophene-3-carboxamide (PubChem CID 79614506) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 5-[[[1-(ethylamino)-1-oxopropan-2-yl]amino]methyl]thiophene-3-carboxamide.
| Compound Name | 5-[[[1-(ethylamino)-1-oxopropan-2-yl]amino]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 79614506 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 5-[[[1-(ethylamino)-1-oxopropan-2-yl]amino]methyl]thiophene-3-carboxamide |
| SMILES | CCNC(=O)C(C)NCc1cc(C(N)=O)cs1 |
| InChI | InChI=1S/C11H17N3O2S/c1-3-13-11(16)7(2)14-5-9-4-8(6-17-9)10(12)15/h4,6-7,14H,3,5H2,1-2H3,(H2,12,15)(H,13,16) |
| InChIKey | LAUVFARWLUNDLY-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |