C16H28N2O2 — CID 79615256
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(1-hydroxycyclohexyl)methyl]acetamide (PubChem CID 79615256) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(1-hydroxycyclohexyl)methyl]acetamide.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(1-hydroxycyclohexyl)methyl]acetamide |
|---|---|
| PubChem CID | 79615256 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(1-hydroxycyclohexyl)methyl]acetamide |
| SMILES | O=C(CC1CC2CCC(C1)N2)NCC1(O)CCCCC1 |
| InChI | InChI=1S/C16H28N2O2/c19-15(17-11-16(20)6-2-1-3-7-16)10-12-8-13-4-5-14(9-12)18-13/h12-14,18,20H,1-11H2,(H,17,19) |
| InChIKey | ACXKGESJQIBCGM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |