C19H21FN2O5S — CID 7961607
[2-(2-ethyl-6-methylanilino)-2-oxoethyl] 2-[(3-fluorophenyl)sulfonylamino]acetate (PubChem CID 7961607) has the molecular formula C19H21FN2O5S and a molecular weight of 408.45 g/mol. Its IUPAC name is [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 2-[(3-fluorophenyl)sulfonylamino]acetate.
| Compound Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 2-[(3-fluorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 7961607 |
| Molecular Formula | C19H21FN2O5S |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 2-[(3-fluorophenyl)sulfonylamino]acetate |
| SMILES | CCc1cccc(C)c1NC(=O)COC(=O)CNS(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C19H21FN2O5S/c1-3-14-7-4-6-13(2)19(14)22-17(23)12-27-18(24)11-21-28(25,26)16-9-5-8-15(20)10-16/h4-10,21H,3,11-12H2,1-2H3,(H,22,23) |
| InChIKey | XQVPDRNYRASQQD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |