About 2-methoxyhept-5-yn-3-ol
2-methoxyhept-5-yn-3-ol (PubChem CID 79617738) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is 2-methoxyhept-5-yn-3-ol.
Molecular Properties
| Compound Name | 2-methoxyhept-5-yn-3-ol |
| PubChem CID | 79617738 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 2-methoxyhept-5-yn-3-ol |
| SMILES | CC#CCC(O)C(C)OC |
| InChI | InChI=1S/C8H14O2/c1-4-5-6-8(9)7(2)10-3/h7-9H,6H2,1-3H3 |
| InChIKey | CSNIKKZFLPOTAB-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyhept-5-yn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyhept-5-yn-3-ol?
The IUPAC name of 2-methoxyhept-5-yn-3-ol (CID 79617738) is 2-methoxyhept-5-yn-3-ol.
What is the SMILES notation for 2-methoxyhept-5-yn-3-ol?
The canonical SMILES for 2-methoxyhept-5-yn-3-ol is CC#CCC(O)C(C)OC.
What is the InChIKey of 2-methoxyhept-5-yn-3-ol?
The InChIKey is CSNIKKZFLPOTAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-4-5-6-8(9)7(2)10-3/h7-9H,6H2,1-3H3.
What are the key properties of 2-methoxyhept-5-yn-3-ol?
2-methoxyhept-5-yn-3-ol has a molecular weight of 142.20 g/mol, XLogP of 0.80, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyhept-5-yn-3-ol is sourced from PubChem (CID 79617738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).