C13H17F2NO — CID 79618474
3-(2,3-difluorophenoxy)-N-methylcyclohexan-1-amine (PubChem CID 79618474) has the molecular formula C13H17F2NO and a molecular weight of 241.28 g/mol. Its IUPAC name is 3-(2,3-difluorophenoxy)-N-methylcyclohexan-1-amine.
| Compound Name | 3-(2,3-difluorophenoxy)-N-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 79618474 |
| Molecular Formula | C13H17F2NO |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 3-(2,3-difluorophenoxy)-N-methylcyclohexan-1-amine |
| SMILES | CNC1CCCC(Oc2cccc(F)c2F)C1 |
| InChI | InChI=1S/C13H17F2NO/c1-16-9-4-2-5-10(8-9)17-12-7-3-6-11(14)13(12)15/h3,6-7,9-10,16H,2,4-5,8H2,1H3 |
| InChIKey | NHLSPESPWKUMSG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |